C20H10I4 — CID 102479738
1-(2,3-diiodonaphthalen-1-yl)-2,3-diiodonaphthalene (PubChem CID 102479738) has the molecular formula C20H10I4 and a molecular weight of 757.92 g/mol. Its IUPAC name is 1-(2,3-diiodonaphthalen-1-yl)-2,3-diiodonaphthalene.
| Compound Name | 1-(2,3-diiodonaphthalen-1-yl)-2,3-diiodonaphthalene |
|---|---|
| PubChem CID | 102479738 |
| Molecular Formula | C20H10I4 |
| Molecular Weight | 757.92 g/mol |
| Exact Mass | 757.70 |
| IUPAC Name | 1-(2,3-diiodonaphthalen-1-yl)-2,3-diiodonaphthalene |
| SMILES | Ic1cc2ccccc2c(-c2c(I)c(I)cc3ccccc23)c1I |
| InChI | InChI=1S/C20H10I4/c21-15-9-11-5-1-3-7-13(11)17(19(15)23)18-14-8-4-2-6-12(14)10-16(22)20(18)24/h1-10H |
| InChIKey | VCFDVGCQJFWHDJ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.92 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|