C18H9I3 — CID 174837521
1,2,3-triiodotriphenylene (PubChem CID 174837521) has the molecular formula C18H9I3 and a molecular weight of 605.98 g/mol. Its IUPAC name is 1,2,3-triiodotriphenylene.
| Compound Name | 1,2,3-triiodotriphenylene |
|---|---|
| PubChem CID | 174837521 |
| Molecular Formula | C18H9I3 |
| Molecular Weight | 605.98 g/mol |
| Exact Mass | 605.78 |
| IUPAC Name | 1,2,3-triiodotriphenylene |
| SMILES | Ic1cc2c3ccccc3c3ccccc3c2c(I)c1I |
| InChI | InChI=1S/C18H9I3/c19-15-9-14-12-7-2-1-5-10(12)11-6-3-4-8-13(11)16(14)18(21)17(15)20/h1-9H |
| InChIKey | OGFHTTWQDZYAHS-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.98 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|