C18H10I2 — CID 88920263
1,2-diiodotriphenylene (PubChem CID 88920263) has the molecular formula C18H10I2 and a molecular weight of 480.09 g/mol. Its IUPAC name is 1,2-diiodotriphenylene.
| Compound Name | 1,2-diiodotriphenylene |
|---|---|
| PubChem CID | 88920263 |
| Molecular Formula | C18H10I2 |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 479.89 |
| IUPAC Name | 1,2-diiodotriphenylene |
| SMILES | Ic1ccc2c3ccccc3c3ccccc3c2c1I |
| InChI | InChI=1S/C18H10I2/c19-16-10-9-15-13-7-2-1-5-11(13)12-6-3-4-8-14(12)17(15)18(16)20/h1-10H |
| InChIKey | CACCTVHBYFFPRR-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|