C15H12Cl2O3 — CID 102480202
1,3-dichloropropan-2-yl 2-naphthalen-2-yl-2-oxoacetate (PubChem CID 102480202) has the molecular formula C15H12Cl2O3 and a molecular weight of 311.16 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl 2-naphthalen-2-yl-2-oxoacetate.
| Compound Name | 1,3-dichloropropan-2-yl 2-naphthalen-2-yl-2-oxoacetate |
|---|---|
| PubChem CID | 102480202 |
| Molecular Formula | C15H12Cl2O3 |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | 1,3-dichloropropan-2-yl 2-naphthalen-2-yl-2-oxoacetate |
| SMILES | O=C(OC(CCl)CCl)C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H12Cl2O3/c16-8-13(9-17)20-15(19)14(18)12-6-5-10-3-1-2-4-11(10)7-12/h1-7,13H,8-9H2 |
| InChIKey | SDNUWABEWGVWIA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|