C22H24O8 — CID 177435126
dipropan-2-yl (2R,3R)-2-hydroxy-3-(2-naphthalen-2-yl-2-oxoacetyl)oxybutanedioate (PubChem CID 177435126) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is dipropan-2-yl (2R,3R)-2-hydroxy-3-(2-naphthalen-2-yl-2-oxoacetyl)oxybutanedioate.
| Compound Name | dipropan-2-yl (2R,3R)-2-hydroxy-3-(2-naphthalen-2-yl-2-oxoacetyl)oxybutanedioate |
|---|---|
| PubChem CID | 177435126 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | dipropan-2-yl (2R,3R)-2-hydroxy-3-(2-naphthalen-2-yl-2-oxoacetyl)oxybutanedioate |
| SMILES | CC(C)OC(=O)[C@H](O)[C@@H](OC(=O)C(=O)c1ccc2ccccc2c1)C(=O)OC(C)C |
| InChI | InChI=1S/C22H24O8/c1-12(2)28-21(26)18(24)19(22(27)29-13(3)4)30-20(25)17(23)16-10-9-14-7-5-6-8-15(14)11-16/h5-13,18-19,24H,1-4H3/t18-,19-/m1/s1 |
| InChIKey | YPAJPJUQGWECOU-RTBURBONSA-N |
| XLogP | 2.20 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|