C13H25F3O2Si — CID 102481446
(Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohept-2-en-3-ol (PubChem CID 102481446) has the molecular formula C13H25F3O2Si and a molecular weight of 298.42 g/mol. Its IUPAC name is (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohept-2-en-3-ol.
| Compound Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohept-2-en-3-ol |
|---|---|
| PubChem CID | 102481446 |
| Molecular Formula | C13H25F3O2Si |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (Z,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluorohept-2-en-3-ol |
| SMILES | CCC[C@@H](O[Si](C)(C)C(C)(C)C)/C(O)=C/C(F)(F)F |
| InChI | InChI=1S/C13H25F3O2Si/c1-7-8-11(10(17)9-13(14,15)16)18-19(5,6)12(2,3)4/h9,11,17H,7-8H2,1-6H3/b10-9-/t11-/m1/s1 |
| InChIKey | KZTLZLPYOGJGBE-DWOQACPDSA-N |
| XLogP | 5.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|