C12H24F2O3Si — CID 102039375
(Z,2R)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorohex-4-ene-1,2-diol (PubChem CID 102039375) has the molecular formula C12H24F2O3Si and a molecular weight of 282.40 g/mol. Its IUPAC name is (Z,2R)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorohex-4-ene-1,2-diol.
| Compound Name | (Z,2R)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 102039375 |
| Molecular Formula | C12H24F2O3Si |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (Z,2R)-6-[tert-butyl(dimethyl)silyl]oxy-3,3-difluorohex-4-ene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C\C(F)(F)[C@H](O)CO |
| InChI | InChI=1S/C12H24F2O3Si/c1-11(2,3)18(4,5)17-8-6-7-12(13,14)10(16)9-15/h6-7,10,15-16H,8-9H2,1-5H3/b7-6-/t10-/m1/s1 |
| InChIKey | HZVRNKUKMDJSCK-JYESYGNLSA-N |
| XLogP | 2.55 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|