C18H39FO3Si2 — CID 53474554
(Z,2S,3R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-4-en-1-ol (PubChem CID 53474554) has the molecular formula C18H39FO3Si2 and a molecular weight of 378.68 g/mol. Its IUPAC name is (Z,2S,3R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-4-en-1-ol.
| Compound Name | (Z,2S,3R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-4-en-1-ol |
|---|---|
| PubChem CID | 53474554 |
| Molecular Formula | C18H39FO3Si2 |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (Z,2S,3R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-3-fluorohex-4-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C\[C@@H](F)[C@H](CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H39FO3Si2/c1-17(2,3)23(7,8)21-13-11-12-15(19)16(14-20)22-24(9,10)18(4,5)6/h11-12,15-16,20H,13-14H2,1-10H3/b12-11-/t15-,16+/m1/s1 |
| InChIKey | UKHOWUUICNEQBP-WXJRXKGESA-N |
| XLogP | 5.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|