C13H28O2Si — CID 102380375
(E,2R)-1-[tert-butyl(dimethyl)silyl]oxyhept-4-en-2-ol (PubChem CID 102380375) has the molecular formula C13H28O2Si and a molecular weight of 244.45 g/mol. Its IUPAC name is (E,2R)-1-[tert-butyl(dimethyl)silyl]oxyhept-4-en-2-ol.
| Compound Name | (E,2R)-1-[tert-butyl(dimethyl)silyl]oxyhept-4-en-2-ol |
|---|---|
| PubChem CID | 102380375 |
| Molecular Formula | C13H28O2Si |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (E,2R)-1-[tert-butyl(dimethyl)silyl]oxyhept-4-en-2-ol |
| SMILES | CC/C=C/C[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H28O2Si/c1-7-8-9-10-12(14)11-15-16(5,6)13(2,3)4/h8-9,12,14H,7,10-11H2,1-6H3/b9-8+/t12-/m1/s1 |
| InChIKey | DPBLYXVITYDJPZ-IDVQTMNDSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|