C8H16O3Si — CID 11830190
(1S,2S,3S)-3-[hydroxy(dimethyl)silyl]cyclohex-4-ene-1,2-diol (PubChem CID 11830190) has the molecular formula C8H16O3Si and a molecular weight of 188.30 g/mol. Its IUPAC name is (1S,2S,3S)-3-[hydroxy(dimethyl)silyl]cyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2S,3S)-3-[hydroxy(dimethyl)silyl]cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 11830190 |
| Molecular Formula | C8H16O3Si |
| Molecular Weight | 188.30 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (1S,2S,3S)-3-[hydroxy(dimethyl)silyl]cyclohex-4-ene-1,2-diol |
| SMILES | C[Si](C)(O)[C@H]1C=CC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H16O3Si/c1-12(2,11)7-5-3-4-6(9)8(7)10/h3,5-11H,4H2,1-2H3/t6-,7-,8-/m0/s1 |
| InChIKey | XUJNRYMWQDHLND-FXQIFTODSA-N |
| XLogP | 0.24 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|