C12H23FO2Si — CID 11149286
(2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dien-2-ol (PubChem CID 11149286) has the molecular formula C12H23FO2Si and a molecular weight of 246.40 g/mol. Its IUPAC name is (2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dien-2-ol.
| Compound Name | (2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 11149286 |
| Molecular Formula | C12H23FO2Si |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (2R,3E)-1-[tert-butyl(dimethyl)silyl]oxy-4-fluorohexa-3,5-dien-2-ol |
| SMILES | C=C/C(F)=C\[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H23FO2Si/c1-7-10(13)8-11(14)9-15-16(5,6)12(2,3)4/h7-8,11,14H,1,9H2,2-6H3/b10-8+/t11-/m1/s1 |
| InChIKey | NAOQLJOXVXRBCQ-RJCSOLBVSA-N |
| XLogP | 3.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|