C11H21F3O2Si — CID 71531556
(E)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-en-2-ol (PubChem CID 71531556) has the molecular formula C11H21F3O2Si and a molecular weight of 270.37 g/mol. Its IUPAC name is (E)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-en-2-ol.
| Compound Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-en-2-ol |
|---|---|
| PubChem CID | 71531556 |
| Molecular Formula | C11H21F3O2Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | (E)-5-[tert-butyl(dimethyl)silyl]oxy-1,1,1-trifluoropent-3-en-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/C(O)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O2Si/c1-10(2,3)17(4,5)16-8-6-7-9(15)11(12,13)14/h6-7,9,15H,8H2,1-5H3/b7-6+ |
| InChIKey | GOQOMEOEGMBOHX-VOTSOKGWSA-N |
| XLogP | 3.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|