C18H13Cl2F3O2 — CID 102481798
(3S,4S)-3,4-bis(4-chlorophenyl)-3-ethyl-4-(trifluoromethyl)oxetan-2-one (PubChem CID 102481798) has the molecular formula C18H13Cl2F3O2 and a molecular weight of 389.20 g/mol. Its IUPAC name is (3S,4S)-3,4-bis(4-chlorophenyl)-3-ethyl-4-(trifluoromethyl)oxetan-2-one.
| Compound Name | (3S,4S)-3,4-bis(4-chlorophenyl)-3-ethyl-4-(trifluoromethyl)oxetan-2-one |
|---|---|
| PubChem CID | 102481798 |
| Molecular Formula | C18H13Cl2F3O2 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | (3S,4S)-3,4-bis(4-chlorophenyl)-3-ethyl-4-(trifluoromethyl)oxetan-2-one |
| SMILES | CC[C@@]1(c2ccc(Cl)cc2)C(=O)O[C@]1(c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H13Cl2F3O2/c1-2-16(11-3-7-13(19)8-4-11)15(24)25-17(16,18(21,22)23)12-5-9-14(20)10-6-12/h3-10H,2H2,1H3/t16-,17+/m1/s1 |
| InChIKey | GYLUMWYJUHAZRW-SJORKVTESA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|