C14H17BrO4 — CID 102482036
[(1Z)-1-[(3aS,7aS)-6-bromo-3a,7a-dimethyl-5-oxo-4H-1-benzofuran-3-ylidene]ethyl] acetate (PubChem CID 102482036) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is [(1Z)-1-[(3aS,7aS)-6-bromo-3a,7a-dimethyl-5-oxo-4H-1-benzofuran-3-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-1-[(3aS,7aS)-6-bromo-3a,7a-dimethyl-5-oxo-4H-1-benzofuran-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 102482036 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | [(1Z)-1-[(3aS,7aS)-6-bromo-3a,7a-dimethyl-5-oxo-4H-1-benzofuran-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\CO[C@@]2(C)C=C(Br)C(=O)C[C@@]12C |
| InChI | InChI=1S/C14H17BrO4/c1-8(19-9(2)16)10-7-18-14(4)5-11(15)12(17)6-13(10,14)3/h5H,6-7H2,1-4H3/b10-8+/t13-,14-/m0/s1 |
| InChIKey | UOZNEKKJWQFWNB-DBSLZISTSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|