C13H15BrO4 — CID 70689164
[(1Z)-1-[(3aR,7aS)-6-bromo-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate (PubChem CID 70689164) has the molecular formula C13H15BrO4 and a molecular weight of 315.16 g/mol. Its IUPAC name is [(1Z)-1-[(3aR,7aS)-6-bromo-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-1-[(3aR,7aS)-6-bromo-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 70689164 |
| Molecular Formula | C13H15BrO4 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | [(1Z)-1-[(3aR,7aS)-6-bromo-7a-methyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\CO[C@]2(C)C=C(Br)C(=O)C[C@H]12 |
| InChI | InChI=1S/C13H15BrO4/c1-7(18-8(2)15)9-6-17-13(3)5-11(14)12(16)4-10(9)13/h5,10H,4,6H2,1-3H3/b9-7+/t10-,13-/m1/s1 |
| InChIKey | UTDVZVHWFMIOJV-JTVYLNILSA-N |
| XLogP | 2.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|