C14H18O4 — CID 102482032
[(1Z)-1-[(3aS,7aS)-6,7a-dimethyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate (PubChem CID 102482032) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is [(1Z)-1-[(3aS,7aS)-6,7a-dimethyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate.
| Compound Name | [(1Z)-1-[(3aS,7aS)-6,7a-dimethyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate |
|---|---|
| PubChem CID | 102482032 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | [(1Z)-1-[(3aS,7aS)-6,7a-dimethyl-5-oxo-3a,4-dihydro-1-benzofuran-3-ylidene]ethyl] acetate |
| SMILES | CC(=O)O/C(C)=C1\CO[C@@]2(C)C=C(C)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C14H18O4/c1-8-6-14(4)12(5-13(8)16)11(7-17-14)9(2)18-10(3)15/h6,12H,5,7H2,1-4H3/b11-9+/t12-,14-/m0/s1 |
| InChIKey | GGAMWHRXEZKJAP-ZFYXDYSTSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|