C20H19NO3 — CID 102482824
ethyl 6-methyl-2,3-diphenyl-2H-1,4-oxazine-5-carboxylate (PubChem CID 102482824) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 6-methyl-2,3-diphenyl-2H-1,4-oxazine-5-carboxylate.
| Compound Name | ethyl 6-methyl-2,3-diphenyl-2H-1,4-oxazine-5-carboxylate |
|---|---|
| PubChem CID | 102482824 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | ethyl 6-methyl-2,3-diphenyl-2H-1,4-oxazine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)OC(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C20H19NO3/c1-3-23-20(22)17-14(2)24-19(16-12-8-5-9-13-16)18(21-17)15-10-6-4-7-11-15/h4-13,19H,3H2,1-2H3 |
| InChIKey | ZSZHQDVBXWUYNH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |