C19H24O3 — CID 102483124
(3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-propyl-3,4,5,6-tetrahydro-2H-pentalen-1-one (PubChem CID 102483124) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-propyl-3,4,5,6-tetrahydro-2H-pentalen-1-one.
| Compound Name | (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-propyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
|---|---|
| PubChem CID | 102483124 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3aS,4S,5R,6aS)-4-benzoyl-3a-hydroxy-6a-methyl-5-propyl-3,4,5,6-tetrahydro-2H-pentalen-1-one |
| SMILES | CCC[C@@H]1C[C@]2(C)C(=O)CC[C@]2(O)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O3/c1-3-7-14-12-18(2)15(20)10-11-19(18,22)16(14)17(21)13-8-5-4-6-9-13/h4-6,8-9,14,16,22H,3,7,10-12H2,1-2H3/t14-,16-,18-,19+/m1/s1 |
| InChIKey | OXUYLOIKMKTMPW-OPNNQBFTSA-N |
| XLogP | 3.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |