C15H9BrF2 — CID 102486045
2-bromo-1,5-difluoro-3-[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 102486045) has the molecular formula C15H9BrF2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 2-bromo-1,5-difluoro-3-[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 2-bromo-1,5-difluoro-3-[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 102486045 |
| Molecular Formula | C15H9BrF2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-bromo-1,5-difluoro-3-[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | Cc1ccc(C#Cc2cc(F)cc(F)c2Br)cc1 |
| InChI | InChI=1S/C15H9BrF2/c1-10-2-4-11(5-3-10)6-7-12-8-13(17)9-14(18)15(12)16/h2-5,8-9H,1H3 |
| InChIKey | LNVBRNPGSCVDBV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|