C23H25F — CID 19786975
6-fluoro-1,1,4,4-tetramethyl-7-[2-(4-methylphenyl)ethynyl]-2,3-dihydronaphthalene (PubChem CID 19786975) has the molecular formula C23H25F and a molecular weight of 320.45 g/mol. Its IUPAC name is 6-fluoro-1,1,4,4-tetramethyl-7-[2-(4-methylphenyl)ethynyl]-2,3-dihydronaphthalene.
| Compound Name | 6-fluoro-1,1,4,4-tetramethyl-7-[2-(4-methylphenyl)ethynyl]-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 19786975 |
| Molecular Formula | C23H25F |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 6-fluoro-1,1,4,4-tetramethyl-7-[2-(4-methylphenyl)ethynyl]-2,3-dihydronaphthalene |
| SMILES | Cc1ccc(C#Cc2cc3c(cc2F)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C23H25F/c1-16-6-8-17(9-7-16)10-11-18-14-19-20(15-21(18)24)23(4,5)13-12-22(19,2)3/h6-9,14-15H,12-13H2,1-5H3 |
| InChIKey | JAFASFNFAYSDOH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|