C15H19NO5S — CID 102487266
ethyl 2-acetyl-3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate (PubChem CID 102487266) has the molecular formula C15H19NO5S and a molecular weight of 325.39 g/mol. Its IUPAC name is ethyl 2-acetyl-3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate.
| Compound Name | ethyl 2-acetyl-3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 102487266 |
| Molecular Formula | C15H19NO5S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl 2-acetyl-3-methyl-1-(4-methylphenyl)sulfonylaziridine-2-carboxylate |
| SMILES | CCOC(=O)C1(C(C)=O)C(C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO5S/c1-5-21-14(18)15(12(4)17)11(3)16(15)22(19,20)13-8-6-10(2)7-9-13/h6-9,11H,5H2,1-4H3 |
| InChIKey | FJAFWSYKUXKWHT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|