C17H21NO7S — CID 102487268
diethyl 2-acetyl-1-(4-methylphenyl)sulfonylaziridine-2,3-dicarboxylate (PubChem CID 102487268) has the molecular formula C17H21NO7S and a molecular weight of 383.42 g/mol. Its IUPAC name is diethyl 2-acetyl-1-(4-methylphenyl)sulfonylaziridine-2,3-dicarboxylate.
| Compound Name | diethyl 2-acetyl-1-(4-methylphenyl)sulfonylaziridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102487268 |
| Molecular Formula | C17H21NO7S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | diethyl 2-acetyl-1-(4-methylphenyl)sulfonylaziridine-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1N(S(=O)(=O)c2ccc(C)cc2)C1(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C17H21NO7S/c1-5-24-15(20)14-17(12(4)19,16(21)25-6-2)18(14)26(22,23)13-9-7-11(3)8-10-13/h7-10,14H,5-6H2,1-4H3 |
| InChIKey | ZIRWKVZGBKYZPH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|