C17H23NO7S — CID 12046121
methyl 4-[[(2R)-1-ethoxy-1-oxopropan-2-yl]-(4-methylphenyl)sulfonylamino]-2-oxobutanoate (PubChem CID 12046121) has the molecular formula C17H23NO7S and a molecular weight of 385.44 g/mol. Its IUPAC name is methyl 4-[[(2R)-1-ethoxy-1-oxopropan-2-yl]-(4-methylphenyl)sulfonylamino]-2-oxobutanoate.
| Compound Name | methyl 4-[[(2R)-1-ethoxy-1-oxopropan-2-yl]-(4-methylphenyl)sulfonylamino]-2-oxobutanoate |
|---|---|
| PubChem CID | 12046121 |
| Molecular Formula | C17H23NO7S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl 4-[[(2R)-1-ethoxy-1-oxopropan-2-yl]-(4-methylphenyl)sulfonylamino]-2-oxobutanoate |
| SMILES | CCOC(=O)[C@@H](C)N(CCC(=O)C(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO7S/c1-5-25-16(20)13(3)18(11-10-15(19)17(21)24-4)26(22,23)14-8-6-12(2)7-9-14/h6-9,13H,5,10-11H2,1-4H3/t13-/m1/s1 |
| InChIKey | OBRZZIIXZHZXJG-CYBMUJFWSA-N |
| XLogP | 1.07 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|