C34H44Br4O2S2 — CID 102488090
3,4,13,16-tetrabromo-14,15-didecoxy-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaene (PubChem CID 102488090) has the molecular formula C34H44Br4O2S2 and a molecular weight of 868.47 g/mol. Its IUPAC name is 3,4,13,16-tetrabromo-14,15-didecoxy-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaene.
| Compound Name | 3,4,13,16-tetrabromo-14,15-didecoxy-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaene |
|---|---|
| PubChem CID | 102488090 |
| Molecular Formula | C34H44Br4O2S2 |
| Molecular Weight | 868.47 g/mol |
| Exact Mass | 863.95 |
| IUPAC Name | 3,4,13,16-tetrabromo-14,15-didecoxy-5,8-dithiatetracyclo[10.4.0.02,6.07,11]hexadeca-1,3,6,9,11,13,15-heptaene |
| SMILES | CCCCCCCCCCOc1c(OCCCCCCCCCC)c(Br)c2c(c1Br)c1ccsc1c1sc(Br)c(Br)c12 |
| InChI | InChI=1S/C34H44Br4O2S2/c1-3-5-7-9-11-13-15-17-20-39-30-27(35)24-23-19-22-41-32(23)33-26(29(37)34(38)42-33)25(24)28(36)31(30)40-21-18-16-14-12-10-8-6-4-2/h19,22H,3-18,20-21H2,1-2H3 |
| InChIKey | QWPSOTCFZLXPQX-UHFFFAOYSA-N |
| XLogP | 15.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.47 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|