C28H23BN4O2 — CID 102488637
[4-[3,5-bis(1-methylbenzimidazol-2-yl)phenyl]phenyl]boronic acid (PubChem CID 102488637) has the molecular formula C28H23BN4O2 and a molecular weight of 458.33 g/mol. Its IUPAC name is [4-[3,5-bis(1-methylbenzimidazol-2-yl)phenyl]phenyl]boronic acid.
| Compound Name | [4-[3,5-bis(1-methylbenzimidazol-2-yl)phenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 102488637 |
| Molecular Formula | C28H23BN4O2 |
| Molecular Weight | 458.33 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | [4-[3,5-bis(1-methylbenzimidazol-2-yl)phenyl]phenyl]boronic acid |
| SMILES | Cn1c(-c2cc(-c3ccc(B(O)O)cc3)cc(-c3nc4ccccc4n3C)c2)nc2ccccc21 |
| InChI | InChI=1S/C28H23BN4O2/c1-32-25-9-5-3-7-23(25)30-27(32)20-15-19(18-11-13-22(14-12-18)29(34)35)16-21(17-20)28-31-24-8-4-6-10-26(24)33(28)2/h3-17,34-35H,1-2H3 |
| InChIKey | STMOYLFHTDHAPS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|