C18H33NO3Si — CID 102489137
tert-butyl (4R)-4-[2-[tert-butyl(dimethyl)silyl]ethynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 102489137) has the molecular formula C18H33NO3Si and a molecular weight of 339.55 g/mol. Its IUPAC name is tert-butyl (4R)-4-[2-[tert-butyl(dimethyl)silyl]ethynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-4-[2-[tert-butyl(dimethyl)silyl]ethynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102489137 |
| Molecular Formula | C18H33NO3Si |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl (4R)-4-[2-[tert-butyl(dimethyl)silyl]ethynyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H](C#C[Si](C)(C)C(C)(C)C)COC1(C)C |
| InChI | InChI=1S/C18H33NO3Si/c1-16(2,3)22-15(20)19-14(13-21-18(19,7)8)11-12-23(9,10)17(4,5)6/h14H,13H2,1-10H3/t14-/m1/s1 |
| InChIKey | OARNDETUYFEQFE-CQSZACIVSA-N |
| XLogP | 4.41 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|