C23H41NO4 — CID 143929155
tert-butyl 4-(4-ethyl-3-hydroxy-7,7-dimethylnon-1-ynyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 143929155) has the molecular formula C23H41NO4 and a molecular weight of 395.58 g/mol. Its IUPAC name is tert-butyl 4-(4-ethyl-3-hydroxy-7,7-dimethylnon-1-ynyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-(4-ethyl-3-hydroxy-7,7-dimethylnon-1-ynyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 143929155 |
| Molecular Formula | C23H41NO4 |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.30 |
| IUPAC Name | tert-butyl 4-(4-ethyl-3-hydroxy-7,7-dimethylnon-1-ynyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCC(CCC(C)(C)CC)C(O)C#CC1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H41NO4/c1-10-17(14-15-22(6,7)11-2)19(25)13-12-18-16-27-23(8,9)24(18)20(26)28-21(3,4)5/h17-19,25H,10-11,14-16H2,1-9H3 |
| InChIKey | PCQBOGVKAKJDFC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|