C17H26O5Si — CID 102489797
(1S,2R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione (PubChem CID 102489797) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is (1S,2R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione.
| Compound Name | (1S,2R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione |
|---|---|
| PubChem CID | 102489797 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (1S,2R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C2=CC(=O)O[C@@H]2[C@]2(C)COC(=O)[C@]12C |
| InChI | InChI=1S/C17H26O5Si/c1-15(2,3)23(6,7)22-13-10-8-11(18)21-12(10)16(4)9-20-14(19)17(13,16)5/h8,12-13H,9H2,1-7H3/t12-,13-,16-,17-/m0/s1 |
| InChIKey | UVFVCJCUOLYSAN-PYTWLRIVSA-N |
| XLogP | 2.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|