C21H31BrO5Si — CID 91867438
(1S,2S,7S,8S)-2-(3-bromobut-3-enyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione (PubChem CID 91867438) has the molecular formula C21H31BrO5Si and a molecular weight of 471.46 g/mol. Its IUPAC name is (1S,2S,7S,8S)-2-(3-bromobut-3-enyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione.
| Compound Name | (1S,2S,7S,8S)-2-(3-bromobut-3-enyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione |
|---|---|
| PubChem CID | 91867438 |
| Molecular Formula | C21H31BrO5Si |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (1S,2S,7S,8S)-2-(3-bromobut-3-enyl)-7-[tert-butyl(dimethyl)silyl]oxy-1,8-dimethyl-3,10-dioxatricyclo[6.3.0.02,6]undec-5-ene-4,9-dione |
| SMILES | C=C(Br)CC[C@@]12OC(=O)C=C1[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C21H31BrO5Si/c1-13(22)9-10-21-14(11-15(23)26-21)16(27-28(7,8)18(2,3)4)20(6)17(24)25-12-19(20,21)5/h11,16H,1,9-10,12H2,2-8H3/t16-,19+,20-,21+/m0/s1 |
| InChIKey | SLXGITQZDISYJC-NASSWSRMSA-N |
| XLogP | 4.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|