C17H28N2O2 — CID 102490073
(4R)-2-[(1S,3R)-2,2-dimethyl-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopropyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 102490073) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is (4R)-2-[(1S,3R)-2,2-dimethyl-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopropyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole.
| Compound Name | (4R)-2-[(1S,3R)-2,2-dimethyl-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopropyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102490073 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (4R)-2-[(1S,3R)-2,2-dimethyl-3-[(4R)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]cyclopropyl]-4-propan-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)[C@@H]1COC([C@@H]2[C@H](C3=N[C@H](C(C)C)CO3)C2(C)C)=N1 |
| InChI | InChI=1S/C17H28N2O2/c1-9(2)11-7-20-15(18-11)13-14(17(13,5)6)16-19-12(8-21-16)10(3)4/h9-14H,7-8H2,1-6H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | FSONBDWNXJDKDV-XDQVBPFNSA-N |
| XLogP | 3.17 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |