C21H33N3O3 — CID 11100855
2-[2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,2,3-trimethylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 11100855) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-[2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,2,3-trimethylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,2,3-trimethylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11100855 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 2-[2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-1,2,3-trimethylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(C2(C)C(C)(C3=NC(C)(C)CO3)C2(C)C2=NC(C)(C)CO2)=N1 |
| InChI | InChI=1S/C21H33N3O3/c1-16(2)10-25-13(22-16)19(7)20(8,14-23-17(3,4)11-26-14)21(19,9)15-24-18(5,6)12-27-15/h10-12H2,1-9H3 |
| InChIKey | FWGOBXGVTBPDSK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |