C19H29N3O3 — CID 101234032
2-[(1S,3S)-2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 101234032) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-[(1S,3S)-2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[(1S,3S)-2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 101234032 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | 2-[(1S,3S)-2,3-bis(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-methylcyclopropyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC([C@H]2[C@H](C3=NC(C)(C)CO3)C2(C)C2=NC(C)(C)CO2)=N1 |
| InChI | InChI=1S/C19H29N3O3/c1-16(2)8-23-13(20-16)11-12(14-21-17(3,4)9-24-14)19(11,7)15-22-18(5,6)10-25-15/h11-12H,8-10H2,1-7H3/t11-,12-/m1/s1 |
| InChIKey | YLCCTPDVRVNKGD-VXGBXAGGSA-N |
| XLogP | 2.86 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |