C10H10N2OSe — CID 102491232
1,3-dimethyl-2-selanylidenequinazolin-4-one (PubChem CID 102491232) has the molecular formula C10H10N2OSe and a molecular weight of 253.16 g/mol. Its IUPAC name is 1,3-dimethyl-2-selanylidenequinazolin-4-one.
| Compound Name | 1,3-dimethyl-2-selanylidenequinazolin-4-one |
|---|---|
| PubChem CID | 102491232 |
| Molecular Formula | C10H10N2OSe |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 1,3-dimethyl-2-selanylidenequinazolin-4-one |
| SMILES | Cn1c(=O)c2ccccc2n(C)c1=[Se] |
| InChI | InChI=1S/C10H10N2OSe/c1-11-8-6-4-3-5-7(8)9(13)12(2)10(11)14/h3-6H,1-2H3 |
| InChIKey | DLRQTEZCVPFQMZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|