C12H13ClN2 — CID 102493211
6-chloro-3,4-diethylcinnoline (PubChem CID 102493211) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 6-chloro-3,4-diethylcinnoline.
| Compound Name | 6-chloro-3,4-diethylcinnoline |
|---|---|
| PubChem CID | 102493211 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 6-chloro-3,4-diethylcinnoline |
| SMILES | CCc1nnc2ccc(Cl)cc2c1CC |
| InChI | InChI=1S/C12H13ClN2/c1-3-9-10-7-8(13)5-6-12(10)15-14-11(9)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | GEZGJNCYDRKZKO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |