C14H19ClN2S — CID 142986409
7-chloro-2,3-diethylquinolin-4-amine;methanethiol (PubChem CID 142986409) has the molecular formula C14H19ClN2S and a molecular weight of 282.84 g/mol. Its IUPAC name is 7-chloro-2,3-diethylquinolin-4-amine;methanethiol.
| Compound Name | 7-chloro-2,3-diethylquinolin-4-amine;methanethiol |
|---|---|
| PubChem CID | 142986409 |
| Molecular Formula | C14H19ClN2S |
| Molecular Weight | 282.84 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 7-chloro-2,3-diethylquinolin-4-amine;methanethiol |
| SMILES | CCc1nc2cc(Cl)ccc2c(N)c1CC.CS |
| InChI | InChI=1S/C13H15ClN2.CH4S/c1-3-9-11(4-2)16-12-7-8(14)5-6-10(12)13(9)15;1-2/h5-7H,3-4H2,1-2H3,(H2,15,16);2H,1H3 |
| InChIKey | FSFLVTMIEUFRSF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.84 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|