C10H4F13N — CID 10249466
2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrrole (PubChem CID 10249466) has the molecular formula C10H4F13N and a molecular weight of 385.12 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrrole.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrrole |
|---|---|
| PubChem CID | 10249466 |
| Molecular Formula | C10H4F13N |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 385.01 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-1H-pyrrole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccc[nH]1 |
| InChI | InChI=1S/C10H4F13N/c11-5(12,4-2-1-3-24-4)6(13,14)7(15,16)8(17,18)9(19,20)10(21,22)23/h1-3,24H |
| InChIKey | XRERGUGTFLYCFU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|