C11H21O2P — CID 102496796
3,4-dimethyl-1-pentoxy-2,5-dihydro-1λ5-phosphole 1-oxide (PubChem CID 102496796) has the molecular formula C11H21O2P and a molecular weight of 216.26 g/mol. Its IUPAC name is 3,4-dimethyl-1-pentoxy-2,5-dihydro-1λ5-phosphole 1-oxide.
| Compound Name | 3,4-dimethyl-1-pentoxy-2,5-dihydro-1λ5-phosphole 1-oxide |
|---|---|
| PubChem CID | 102496796 |
| Molecular Formula | C11H21O2P |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3,4-dimethyl-1-pentoxy-2,5-dihydro-1λ5-phosphole 1-oxide |
| SMILES | CCCCCOP1(=O)CC(C)=C(C)C1 |
| InChI | InChI=1S/C11H21O2P/c1-4-5-6-7-13-14(12)8-10(2)11(3)9-14/h4-9H2,1-3H3 |
| InChIKey | NERMXNYYISEXIZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|