C9H11N — CID 102497052
(1R,2S,4S)-2-methylbicyclo[2.2.1]hept-5-ene-2-carbonitrile (PubChem CID 102497052) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is (1R,2S,4S)-2-methylbicyclo[2.2.1]hept-5-ene-2-carbonitrile.
| Compound Name | (1R,2S,4S)-2-methylbicyclo[2.2.1]hept-5-ene-2-carbonitrile |
|---|---|
| PubChem CID | 102497052 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (1R,2S,4S)-2-methylbicyclo[2.2.1]hept-5-ene-2-carbonitrile |
| SMILES | C[C@]1(C#N)C[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C9H11N/c1-9(6-10)5-7-2-3-8(9)4-7/h2-3,7-8H,4-5H2,1H3/t7-,8-,9+/m0/s1 |
| InChIKey | YLSRLICOTNISRM-XHNCKOQMSA-N |
| XLogP | 2.11 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|