C11H14 — CID 141269343
spiro[bicyclo[2.2.1]hept-2-ene-5,4'-cyclopentene] (PubChem CID 141269343) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]hept-2-ene-5,4'-cyclopentene].
| Compound Name | spiro[bicyclo[2.2.1]hept-2-ene-5,4'-cyclopentene] |
|---|---|
| PubChem CID | 141269343 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | spiro[bicyclo[2.2.1]hept-2-ene-5,4'-cyclopentene] |
| SMILES | C1=CCC2(C1)CC1C=CC2C1 |
| InChI | InChI=1S/C11H14/c1-2-6-11(5-1)8-9-3-4-10(11)7-9/h1-4,9-10H,5-8H2 |
| InChIKey | ZASBWHQMJCSRHE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|