C10H14O — CID 130305719
(1S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane] (PubChem CID 130305719) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane].
| Compound Name | (1S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane] |
|---|---|
| PubChem CID | 130305719 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1S)-spiro[bicyclo[2.2.1]hept-2-ene-5,3'-oxolane] |
| SMILES | C1=C[C@H]2CC1C1(CCOC1)C2 |
| InChI | InChI=1S/C10H14O/c1-2-9-5-8(1)6-10(9)3-4-11-7-10/h1-2,8-9H,3-7H2/t8-,9?,10?/m0/s1 |
| InChIKey | ADGFFIZOXFROQT-IDKOKCKLSA-N |
| XLogP | 1.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|