C7H11BrO — CID 129372240
(2R,3R)-2-(bromomethyl)-5-oxaspiro[2.4]heptane (PubChem CID 129372240) has the molecular formula C7H11BrO and a molecular weight of 191.07 g/mol. Its IUPAC name is (2R,3R)-2-(bromomethyl)-5-oxaspiro[2.4]heptane.
| Compound Name | (2R,3R)-2-(bromomethyl)-5-oxaspiro[2.4]heptane |
|---|---|
| PubChem CID | 129372240 |
| Molecular Formula | C7H11BrO |
| Molecular Weight | 191.07 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | (2R,3R)-2-(bromomethyl)-5-oxaspiro[2.4]heptane |
| SMILES | BrC[C@@H]1C[C@@]12CCOC2 |
| InChI | InChI=1S/C7H11BrO/c8-4-6-3-7(6)1-2-9-5-7/h6H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | TVNMGTNGTKSCFB-NKWVEPMBSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|