C7H13NO — CID 124508591
[(2R,3S)-5-oxaspiro[2.4]heptan-2-yl]methanamine (PubChem CID 124508591) has the molecular formula C7H13NO and a molecular weight of 127.19 g/mol. Its IUPAC name is [(2R,3S)-5-oxaspiro[2.4]heptan-2-yl]methanamine.
| Compound Name | [(2R,3S)-5-oxaspiro[2.4]heptan-2-yl]methanamine |
|---|---|
| PubChem CID | 124508591 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | [(2R,3S)-5-oxaspiro[2.4]heptan-2-yl]methanamine |
| SMILES | NC[C@@H]1C[C@]12CCOC2 |
| InChI | InChI=1S/C7H13NO/c8-4-6-3-7(6)1-2-9-5-7/h6H,1-5,8H2/t6-,7-/m0/s1 |
| InChIKey | BSESSGRISLUQGE-BQBZGAKWSA-N |
| XLogP | 0.37 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |