C26H18O16 — CID 102497530
[4,5-dihydroxy-6-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]oxan-3-yl] 3,4,5-trihydroxybenzoate (PubChem CID 102497530) has the molecular formula C26H18O16 and a molecular weight of 586.41 g/mol. Its IUPAC name is [4,5-dihydroxy-6-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]oxan-3-yl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4,5-dihydroxy-6-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]oxan-3-yl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 102497530 |
| Molecular Formula | C26H18O16 |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 586.06 |
| IUPAC Name | [4,5-dihydroxy-6-[(7,13,14-trihydroxy-3,10-dioxo-2,9-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),4,6,8(16),11,13-hexaen-6-yl)oxy]oxan-3-yl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(OC1COC(Oc2cc3c(=O)oc4c(O)c(O)cc5c(=O)oc(c2O)c3c45)C(O)C1O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C26H18O16/c27-9-1-6(2-10(28)16(9)30)23(35)39-13-5-38-26(20(34)18(13)32)40-12-4-8-15-14-7(24(36)42-22(15)19(12)33)3-11(29)17(31)21(14)41-25(8)37/h1-4,13,18,20,26-34H,5H2 |
| InChIKey | BMBGSBIFXCOEBC-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 267.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|