C26H12F18O10S3 — CID 102497779
tris(1,1,1,3,3,3-hexafluoropropan-2-yl) 8-methoxypyrene-1,3,6-trisulfonate (PubChem CID 102497779) has the molecular formula C26H12F18O10S3 and a molecular weight of 922.54 g/mol. Its IUPAC name is tris(1,1,1,3,3,3-hexafluoropropan-2-yl) 8-methoxypyrene-1,3,6-trisulfonate.
| Compound Name | tris(1,1,1,3,3,3-hexafluoropropan-2-yl) 8-methoxypyrene-1,3,6-trisulfonate |
|---|---|
| PubChem CID | 102497779 |
| Molecular Formula | C26H12F18O10S3 |
| Molecular Weight | 922.54 g/mol |
| Exact Mass | 921.93 |
| IUPAC Name | tris(1,1,1,3,3,3-hexafluoropropan-2-yl) 8-methoxypyrene-1,3,6-trisulfonate |
| SMILES | COc1cc(S(=O)(=O)OC(C(F)(F)F)C(F)(F)F)c2ccc3c(S(=O)(=O)OC(C(F)(F)F)C(F)(F)F)cc(S(=O)(=O)OC(C(F)(F)F)C(F)(F)F)c4ccc1c2c43 |
| InChI | InChI=1S/C26H12F18O10S3/c1-51-12-6-13(55(45,46)52-18(21(27,28)29)22(30,31)32)9-4-5-11-15(57(49,50)54-20(25(39,40)41)26(42,43)44)7-14(10-3-2-8(12)16(9)17(10)11)56(47,48)53-19(23(33,34)35)24(36,37)38/h2-7,18-20H,1H3 |
| InChIKey | ISWBWOJSHNSVKL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.54 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|