C19H23F2N5O2 — CID 10249866
N-butyl-3-[(2,4-difluorobenzoyl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 10249866) has the molecular formula C19H23F2N5O2 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-butyl-3-[(2,4-difluorobenzoyl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | N-butyl-3-[(2,4-difluorobenzoyl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 10249866 |
| Molecular Formula | C19H23F2N5O2 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | N-butyl-3-[(2,4-difluorobenzoyl)amino]-6,6-dimethyl-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | CCCCNC(=O)N1Cc2c(NC(=O)c3ccc(F)cc3F)n[nH]c2C1(C)C |
| InChI | InChI=1S/C19H23F2N5O2/c1-4-5-8-22-18(28)26-10-13-15(19(26,2)3)24-25-16(13)23-17(27)12-7-6-11(20)9-14(12)21/h6-7,9H,4-5,8,10H2,1-3H3,(H,22,28)(H2,23,24,25,27) |
| InChIKey | UHVVMOTYTXXJBR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|