C24H19N3O3 — CID 102499214
methyl 2-benzyl-5-methoxy-9,11,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene-13-carboxylate (PubChem CID 102499214) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 2-benzyl-5-methoxy-9,11,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene-13-carboxylate.
| Compound Name | methyl 2-benzyl-5-methoxy-9,11,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene-13-carboxylate |
|---|---|
| PubChem CID | 102499214 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | methyl 2-benzyl-5-methoxy-9,11,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),4,6,9,12,14,16-octaene-13-carboxylate |
| SMILES | COC(=O)c1ccc2nc3c(Cc4ccccc4)c4cc(OC)ccc4nc3n2c1 |
| InChI | InChI=1S/C24H19N3O3/c1-29-17-9-10-20-18(13-17)19(12-15-6-4-3-5-7-15)22-23(25-20)27-14-16(24(28)30-2)8-11-21(27)26-22/h3-11,13-14H,12H2,1-2H3 |
| InChIKey | ZWCKLFPDJSZGGD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |