C21H19ClO8 — CID 102499750
2-[(E,3R)-3-carboxybut-1-enoxy]-6-(3-chloro-6-hydroxy-2-methoxy-4-methylbenzoyl)benzoic acid (PubChem CID 102499750) has the molecular formula C21H19ClO8 and a molecular weight of 434.83 g/mol. Its IUPAC name is 2-[(E,3R)-3-carboxybut-1-enoxy]-6-(3-chloro-6-hydroxy-2-methoxy-4-methylbenzoyl)benzoic acid.
| Compound Name | 2-[(E,3R)-3-carboxybut-1-enoxy]-6-(3-chloro-6-hydroxy-2-methoxy-4-methylbenzoyl)benzoic acid |
|---|---|
| PubChem CID | 102499750 |
| Molecular Formula | C21H19ClO8 |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 2-[(E,3R)-3-carboxybut-1-enoxy]-6-(3-chloro-6-hydroxy-2-methoxy-4-methylbenzoyl)benzoic acid |
| SMILES | COc1c(Cl)c(C)cc(O)c1C(=O)c1cccc(O/C=C/[C@@H](C)C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C21H19ClO8/c1-10(20(25)26)7-8-30-14-6-4-5-12(15(14)21(27)28)18(24)16-13(23)9-11(2)17(22)19(16)29-3/h4-10,23H,1-3H3,(H,25,26)(H,27,28)/b8-7+/t10-/m1/s1 |
| InChIKey | YQNKIXXARYJTMX-QROSGCPLSA-N |
| XLogP | 3.91 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|