C6H4N4O2 — CID 10250
1H-pteridine-2,4-dione (PubChem CID 10250) has the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. Its IUPAC name is 1H-pteridine-2,4-dione.
| Compound Name | 1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 10250 |
| Molecular Formula | C6H4N4O2 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 1H-pteridine-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2nccnc2[nH]1 |
| InChI | InChI=1S/C6H4N4O2/c11-5-3-4(8-2-1-7-3)9-6(12)10-5/h1-2H,(H2,8,9,10,11,12) |
| InChIKey | UYEUUXMDVNYCAM-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |