C7H6N4O2 — CID 556817
1-methylpteridine-2,4-dione (PubChem CID 556817) has the molecular formula C7H6N4O2 and a molecular weight of 178.15 g/mol. Its IUPAC name is 1-methylpteridine-2,4-dione.
| Compound Name | 1-methylpteridine-2,4-dione |
|---|---|
| PubChem CID | 556817 |
| Molecular Formula | C7H6N4O2 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 1-methylpteridine-2,4-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2nccnc21 |
| InChI | InChI=1S/C7H6N4O2/c1-11-5-4(8-2-3-9-5)6(12)10-7(11)13/h2-3H,1H3,(H,10,12,13) |
| InChIKey | UYKSIAWLPKJVJX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |