C16H19NO3 — CID 102500965
tert-butyl N-[2-(3-hydroxypent-1-en-4-yn-3-yl)phenyl]carbamate (PubChem CID 102500965) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is tert-butyl N-[2-(3-hydroxypent-1-en-4-yn-3-yl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-hydroxypent-1-en-4-yn-3-yl)phenyl]carbamate |
|---|---|
| PubChem CID | 102500965 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | tert-butyl N-[2-(3-hydroxypent-1-en-4-yn-3-yl)phenyl]carbamate |
| SMILES | C#CC(O)(C=C)c1ccccc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H19NO3/c1-6-16(19,7-2)12-10-8-9-11-13(12)17-14(18)20-15(3,4)5/h1,7-11,19H,2H2,3-5H3,(H,17,18) |
| InChIKey | AKCGCUSVAPUOFK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|